C16H14BrClN2OS — CID 53273420
N-[[5-(5-bromofuran-2-yl)-1,3-thiazol-2-yl]methyl]-2-(4-chlorophenyl)ethanamine (PubChem CID 53273420) has the molecular formula C16H14BrClN2OS and a molecular weight of 397.73 g/mol. Its IUPAC name is N-[[5-(5-bromofuran-2-yl)-1,3-thiazol-2-yl]methyl]-2-(4-chlorophenyl)ethanamine.
| Compound Name | N-[[5-(5-bromofuran-2-yl)-1,3-thiazol-2-yl]methyl]-2-(4-chlorophenyl)ethanamine |
|---|---|
| PubChem CID | 53273420 |
| Molecular Formula | C16H14BrClN2OS |
| Molecular Weight | 397.73 g/mol |
| Exact Mass | 395.97 |
| IUPAC Name | N-[[5-(5-bromofuran-2-yl)-1,3-thiazol-2-yl]methyl]-2-(4-chlorophenyl)ethanamine |
| SMILES | Clc1ccc(CCNCc2ncc(-c3ccc(Br)o3)s2)cc1 |
| InChI | InChI=1S/C16H14BrClN2OS/c17-15-6-5-13(21-15)14-9-20-16(22-14)10-19-8-7-11-1-3-12(18)4-2-11/h1-6,9,19H,7-8,10H2 |
| InChIKey | DNVCIPFFNNGLIL-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.73 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|