C16H16N2OS — CID 53272762
N-[[5-(furan-2-yl)-1,3-thiazol-2-yl]methyl]-2-phenylethanamine (PubChem CID 53272762) has the molecular formula C16H16N2OS and a molecular weight of 284.38 g/mol. Its IUPAC name is N-[[5-(furan-2-yl)-1,3-thiazol-2-yl]methyl]-2-phenylethanamine.
| Compound Name | N-[[5-(furan-2-yl)-1,3-thiazol-2-yl]methyl]-2-phenylethanamine |
|---|---|
| PubChem CID | 53272762 |
| Molecular Formula | C16H16N2OS |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | N-[[5-(furan-2-yl)-1,3-thiazol-2-yl]methyl]-2-phenylethanamine |
| SMILES | c1ccc(CCNCc2ncc(-c3ccco3)s2)cc1 |
| InChI | InChI=1S/C16H16N2OS/c1-2-5-13(6-3-1)8-9-17-12-16-18-11-15(20-16)14-7-4-10-19-14/h1-7,10-11,17H,8-9,12H2 |
| InChIKey | VDKRLRMDWJNDCI-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|