C14H16Cl2N2S — CID 64539502
2-(2,4-dichlorophenyl)-N-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]ethanamine (PubChem CID 64539502) has the molecular formula C14H16Cl2N2S and a molecular weight of 315.27 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-N-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]ethanamine.
| Compound Name | 2-(2,4-dichlorophenyl)-N-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 64539502 |
| Molecular Formula | C14H16Cl2N2S |
| Molecular Weight | 315.27 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-N-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]ethanamine |
| SMILES | Cc1nc(C)c(CNCCc2ccc(Cl)cc2Cl)s1 |
| InChI | InChI=1S/C14H16Cl2N2S/c1-9-14(19-10(2)18-9)8-17-6-5-11-3-4-12(15)7-13(11)16/h3-4,7,17H,5-6,8H2,1-2H3 |
| InChIKey | ANAFGDHVSHELIO-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.27 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|