C15H19Cl2N3 — CID 30054388
2-(2,4-dichlorophenyl)-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]ethanamine (PubChem CID 30054388) has the molecular formula C15H19Cl2N3 and a molecular weight of 312.24 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]ethanamine.
| Compound Name | 2-(2,4-dichlorophenyl)-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 30054388 |
| Molecular Formula | C15H19Cl2N3 |
| Molecular Weight | 312.24 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]ethanamine |
| SMILES | Cc1nn(C)c(C)c1CNCCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H19Cl2N3/c1-10-14(11(2)20(3)19-10)9-18-7-6-12-4-5-13(16)8-15(12)17/h4-5,8,18H,6-7,9H2,1-3H3 |
| InChIKey | GRCSUQSIRXSUNY-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.24 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|