C15H14Cl4FN — CID 17209609
N-[(2-chloro-6-fluorophenyl)methyl]-2-(2,4-dichlorophenyl)ethanamine;hydrochloride (PubChem CID 17209609) has the molecular formula C15H14Cl4FN and a molecular weight of 369.09 g/mol. Its IUPAC name is N-[(2-chloro-6-fluorophenyl)methyl]-2-(2,4-dichlorophenyl)ethanamine;hydrochloride.
| Compound Name | N-[(2-chloro-6-fluorophenyl)methyl]-2-(2,4-dichlorophenyl)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 17209609 |
| Molecular Formula | C15H14Cl4FN |
| Molecular Weight | 369.09 g/mol |
| Exact Mass | 366.99 |
| IUPAC Name | N-[(2-chloro-6-fluorophenyl)methyl]-2-(2,4-dichlorophenyl)ethanamine;hydrochloride |
| SMILES | Cl.Fc1cccc(Cl)c1CNCCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H13Cl3FN.ClH/c16-11-5-4-10(14(18)8-11)6-7-20-9-12-13(17)2-1-3-15(12)19;/h1-5,8,20H,6-7,9H2;1H |
| InChIKey | PJELHELPXQGAET-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.09 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|