C15H14ClF2N — CID 114841353
N-[(4-chloro-2-fluorophenyl)methyl]-2-(2-fluorophenyl)ethanamine (PubChem CID 114841353) has the molecular formula C15H14ClF2N and a molecular weight of 281.73 g/mol. Its IUPAC name is N-[(4-chloro-2-fluorophenyl)methyl]-2-(2-fluorophenyl)ethanamine.
| Compound Name | N-[(4-chloro-2-fluorophenyl)methyl]-2-(2-fluorophenyl)ethanamine |
|---|---|
| PubChem CID | 114841353 |
| Molecular Formula | C15H14ClF2N |
| Molecular Weight | 281.73 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | N-[(4-chloro-2-fluorophenyl)methyl]-2-(2-fluorophenyl)ethanamine |
| SMILES | Fc1ccccc1CCNCc1ccc(Cl)cc1F |
| InChI | InChI=1S/C15H14ClF2N/c16-13-6-5-12(15(18)9-13)10-19-8-7-11-3-1-2-4-14(11)17/h1-6,9,19H,7-8,10H2 |
| InChIKey | AADOMVGSFBHKPN-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.73 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|