C14H14ClFN2 — CID 114842036
N-[(4-chloro-2-fluorophenyl)methyl]-2-pyridin-3-ylethanamine (PubChem CID 114842036) has the molecular formula C14H14ClFN2 and a molecular weight of 264.73 g/mol. Its IUPAC name is N-[(4-chloro-2-fluorophenyl)methyl]-2-pyridin-3-ylethanamine.
| Compound Name | N-[(4-chloro-2-fluorophenyl)methyl]-2-pyridin-3-ylethanamine |
|---|---|
| PubChem CID | 114842036 |
| Molecular Formula | C14H14ClFN2 |
| Molecular Weight | 264.73 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | N-[(4-chloro-2-fluorophenyl)methyl]-2-pyridin-3-ylethanamine |
| SMILES | Fc1cc(Cl)ccc1CNCCc1cccnc1 |
| InChI | InChI=1S/C14H14ClFN2/c15-13-4-3-12(14(16)8-13)10-18-7-5-11-2-1-6-17-9-11/h1-4,6,8-9,18H,5,7,10H2 |
| InChIKey | OCWLDKKDMNSKQR-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.73 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|