C10H10ClFN2 — CID 28728531
3-[(2-chloro-6-fluorophenyl)methylamino]propanenitrile (PubChem CID 28728531) has the molecular formula C10H10ClFN2 and a molecular weight of 212.66 g/mol. Its IUPAC name is 3-[(2-chloro-6-fluorophenyl)methylamino]propanenitrile.
| Compound Name | 3-[(2-chloro-6-fluorophenyl)methylamino]propanenitrile |
|---|---|
| PubChem CID | 28728531 |
| Molecular Formula | C10H10ClFN2 |
| Molecular Weight | 212.66 g/mol |
| Exact Mass | 212.05 |
| IUPAC Name | 3-[(2-chloro-6-fluorophenyl)methylamino]propanenitrile |
| SMILES | N#CCCNCc1c(F)cccc1Cl |
| InChI | InChI=1S/C10H10ClFN2/c11-9-3-1-4-10(12)8(9)7-14-6-2-5-13/h1,3-4,14H,2,6-7H2 |
| InChIKey | VMSDQLWCGUAHFC-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.66 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|