C13H21ClFN — CID 142079135
N-[(2-chloro-6-fluorophenyl)methyl]-2-methylpropan-1-amine;ethane (PubChem CID 142079135) has the molecular formula C13H21ClFN and a molecular weight of 245.77 g/mol. Its IUPAC name is N-[(2-chloro-6-fluorophenyl)methyl]-2-methylpropan-1-amine;ethane.
| Compound Name | N-[(2-chloro-6-fluorophenyl)methyl]-2-methylpropan-1-amine;ethane |
|---|---|
| PubChem CID | 142079135 |
| Molecular Formula | C13H21ClFN |
| Molecular Weight | 245.77 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | N-[(2-chloro-6-fluorophenyl)methyl]-2-methylpropan-1-amine;ethane |
| SMILES | CC.CC(C)CNCc1c(F)cccc1Cl |
| InChI | InChI=1S/C11H15ClFN.C2H6/c1-8(2)6-14-7-9-10(12)4-3-5-11(9)13;1-2/h3-5,8,14H,6-7H2,1-2H3;1-2H3 |
| InChIKey | BOIREDPRHXEMAY-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.77 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |