C12H18ClFN2 — CID 17215446
N'-[(2-chloro-6-fluorophenyl)methyl]-N-ethylpropane-1,3-diamine (PubChem CID 17215446) has the molecular formula C12H18ClFN2 and a molecular weight of 244.74 g/mol. Its IUPAC name is N'-[(2-chloro-6-fluorophenyl)methyl]-N-ethylpropane-1,3-diamine.
| Compound Name | N'-[(2-chloro-6-fluorophenyl)methyl]-N-ethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 17215446 |
| Molecular Formula | C12H18ClFN2 |
| Molecular Weight | 244.74 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | N'-[(2-chloro-6-fluorophenyl)methyl]-N-ethylpropane-1,3-diamine |
| SMILES | CCNCCCNCc1c(F)cccc1Cl |
| InChI | InChI=1S/C12H18ClFN2/c1-2-15-7-4-8-16-9-10-11(13)5-3-6-12(10)14/h3,5-6,15-16H,2,4,7-9H2,1H3 |
| InChIKey | TVYMTJJGHIHUJQ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.74 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|