C13H22Cl3FN2 — CID 17294849
N-[(2-chloro-6-fluorophenyl)methyl]-N',N'-diethylethane-1,2-diamine;dihydrochloride (PubChem CID 17294849) has the molecular formula C13H22Cl3FN2 and a molecular weight of 331.69 g/mol. Its IUPAC name is N-[(2-chloro-6-fluorophenyl)methyl]-N',N'-diethylethane-1,2-diamine;dihydrochloride.
| Compound Name | N-[(2-chloro-6-fluorophenyl)methyl]-N',N'-diethylethane-1,2-diamine;dihydrochloride |
|---|---|
| PubChem CID | 17294849 |
| Molecular Formula | C13H22Cl3FN2 |
| Molecular Weight | 331.69 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | N-[(2-chloro-6-fluorophenyl)methyl]-N',N'-diethylethane-1,2-diamine;dihydrochloride |
| SMILES | CCN(CC)CCNCc1c(F)cccc1Cl.Cl.Cl |
| InChI | InChI=1S/C13H20ClFN2.2ClH/c1-3-17(4-2)9-8-16-10-11-12(14)6-5-7-13(11)15;;/h5-7,16H,3-4,8-10H2,1-2H3;2*1H |
| InChIKey | AWISBAZEVOILMS-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.69 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|