C10H14Cl3N — CID 17290865
N-[(2,6-dichlorophenyl)methyl]propan-1-amine;hydrochloride (PubChem CID 17290865) has the molecular formula C10H14Cl3N and a molecular weight of 254.59 g/mol. Its IUPAC name is N-[(2,6-dichlorophenyl)methyl]propan-1-amine;hydrochloride.
| Compound Name | N-[(2,6-dichlorophenyl)methyl]propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17290865 |
| Molecular Formula | C10H14Cl3N |
| Molecular Weight | 254.59 g/mol |
| Exact Mass | 253.02 |
| IUPAC Name | N-[(2,6-dichlorophenyl)methyl]propan-1-amine;hydrochloride |
| SMILES | CCCNCc1c(Cl)cccc1Cl.Cl |
| InChI | InChI=1S/C10H13Cl2N.ClH/c1-2-6-13-7-8-9(11)4-3-5-10(8)12;/h3-5,13H,2,6-7H2,1H3;1H |
| InChIKey | IKSLKILHZYJJAG-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.59 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|