C18H21Cl5N2S2 — CID 15574751
N-[(2,6-dichlorophenyl)methyl]-2-[2-[(2,6-dichlorophenyl)methylamino]ethyldisulfanyl]ethanamine;hydrochloride (PubChem CID 15574751) has the molecular formula C18H21Cl5N2S2 and a molecular weight of 506.78 g/mol. Its IUPAC name is N-[(2,6-dichlorophenyl)methyl]-2-[2-[(2,6-dichlorophenyl)methylamino]ethyldisulfanyl]ethanamine;hydrochloride.
| Compound Name | N-[(2,6-dichlorophenyl)methyl]-2-[2-[(2,6-dichlorophenyl)methylamino]ethyldisulfanyl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 15574751 |
| Molecular Formula | C18H21Cl5N2S2 |
| Molecular Weight | 506.78 g/mol |
| Exact Mass | 503.96 |
| IUPAC Name | N-[(2,6-dichlorophenyl)methyl]-2-[2-[(2,6-dichlorophenyl)methylamino]ethyldisulfanyl]ethanamine;hydrochloride |
| SMILES | Cl.Clc1cccc(Cl)c1CNCCSSCCNCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C18H20Cl4N2S2.ClH/c19-15-3-1-4-16(20)13(15)11-23-7-9-25-26-10-8-24-12-14-17(21)5-2-6-18(14)22;/h1-6,23-24H,7-12H2;1H |
| InChIKey | MYKWSGAYKFQHHF-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.78 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|