C10H10Cl2F3N — CID 63226497
N-[(2,6-dichlorophenyl)methyl]-3,3,3-trifluoropropan-1-amine (PubChem CID 63226497) has the molecular formula C10H10Cl2F3N and a molecular weight of 272.10 g/mol. Its IUPAC name is N-[(2,6-dichlorophenyl)methyl]-3,3,3-trifluoropropan-1-amine.
| Compound Name | N-[(2,6-dichlorophenyl)methyl]-3,3,3-trifluoropropan-1-amine |
|---|---|
| PubChem CID | 63226497 |
| Molecular Formula | C10H10Cl2F3N |
| Molecular Weight | 272.10 g/mol |
| Exact Mass | 271.01 |
| IUPAC Name | N-[(2,6-dichlorophenyl)methyl]-3,3,3-trifluoropropan-1-amine |
| SMILES | FC(F)(F)CCNCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C10H10Cl2F3N/c11-8-2-1-3-9(12)7(8)6-16-5-4-10(13,14)15/h1-3,16H,4-6H2 |
| InChIKey | GJIITIXUBDRZSF-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.10 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|