C11H13ClF3N — CID 65025247
N-[[3-(chloromethyl)phenyl]methyl]-3,3,3-trifluoropropan-1-amine (PubChem CID 65025247) has the molecular formula C11H13ClF3N and a molecular weight of 251.68 g/mol. Its IUPAC name is N-[[3-(chloromethyl)phenyl]methyl]-3,3,3-trifluoropropan-1-amine.
| Compound Name | N-[[3-(chloromethyl)phenyl]methyl]-3,3,3-trifluoropropan-1-amine |
|---|---|
| PubChem CID | 65025247 |
| Molecular Formula | C11H13ClF3N |
| Molecular Weight | 251.68 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | N-[[3-(chloromethyl)phenyl]methyl]-3,3,3-trifluoropropan-1-amine |
| SMILES | FC(F)(F)CCNCc1cccc(CCl)c1 |
| InChI | InChI=1S/C11H13ClF3N/c12-7-9-2-1-3-10(6-9)8-16-5-4-11(13,14)15/h1-3,6,16H,4-5,7-8H2 |
| InChIKey | MLJONYQZDIWVOV-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.68 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|