C16H16ClF2N — CID 116790548
N-[[3-(chloromethyl)phenyl]methyl]-2,2-difluoro-2-phenylethanamine (PubChem CID 116790548) has the molecular formula C16H16ClF2N and a molecular weight of 295.76 g/mol. Its IUPAC name is N-[[3-(chloromethyl)phenyl]methyl]-2,2-difluoro-2-phenylethanamine.
| Compound Name | N-[[3-(chloromethyl)phenyl]methyl]-2,2-difluoro-2-phenylethanamine |
|---|---|
| PubChem CID | 116790548 |
| Molecular Formula | C16H16ClF2N |
| Molecular Weight | 295.76 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | N-[[3-(chloromethyl)phenyl]methyl]-2,2-difluoro-2-phenylethanamine |
| SMILES | FC(F)(CNCc1cccc(CCl)c1)c1ccccc1 |
| InChI | InChI=1S/C16H16ClF2N/c17-10-13-5-4-6-14(9-13)11-20-12-16(18,19)15-7-2-1-3-8-15/h1-9,20H,10-12H2 |
| InChIKey | WROSUDPXQCTNCV-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.76 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|