C16H15F4N — CID 116789040
N-[2-(3,5-difluorophenyl)ethyl]-2,2-difluoro-2-phenylethanamine (PubChem CID 116789040) has the molecular formula C16H15F4N and a molecular weight of 297.30 g/mol. Its IUPAC name is N-[2-(3,5-difluorophenyl)ethyl]-2,2-difluoro-2-phenylethanamine.
| Compound Name | N-[2-(3,5-difluorophenyl)ethyl]-2,2-difluoro-2-phenylethanamine |
|---|---|
| PubChem CID | 116789040 |
| Molecular Formula | C16H15F4N |
| Molecular Weight | 297.30 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | N-[2-(3,5-difluorophenyl)ethyl]-2,2-difluoro-2-phenylethanamine |
| SMILES | Fc1cc(F)cc(CCNCC(F)(F)c2ccccc2)c1 |
| InChI | InChI=1S/C16H15F4N/c17-14-8-12(9-15(18)10-14)6-7-21-11-16(19,20)13-4-2-1-3-5-13/h1-5,8-10,21H,6-7,11H2 |
| InChIKey | KLRNTERAAHXNNN-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.30 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|