C14H12F2 — CID 90780533
1,3-difluoro-5-(2-phenylethyl)benzene (PubChem CID 90780533) has the molecular formula C14H12F2 and a molecular weight of 218.25 g/mol. Its IUPAC name is 1,3-difluoro-5-(2-phenylethyl)benzene.
| Compound Name | 1,3-difluoro-5-(2-phenylethyl)benzene |
|---|---|
| PubChem CID | 90780533 |
| Molecular Formula | C14H12F2 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 1,3-difluoro-5-(2-phenylethyl)benzene |
| SMILES | Fc1cc(F)cc(CCc2ccccc2)c1 |
| InChI | InChI=1S/C14H12F2/c15-13-8-12(9-14(16)10-13)7-6-11-4-2-1-3-5-11/h1-5,8-10H,6-7H2 |
| InChIKey | GZNWCGRYSRUBPU-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |