C11H12F5N — CID 64554825
N-[2-(3,5-difluorophenyl)ethyl]-3,3,3-trifluoropropan-1-amine (PubChem CID 64554825) has the molecular formula C11H12F5N and a molecular weight of 253.21 g/mol. Its IUPAC name is N-[2-(3,5-difluorophenyl)ethyl]-3,3,3-trifluoropropan-1-amine.
| Compound Name | N-[2-(3,5-difluorophenyl)ethyl]-3,3,3-trifluoropropan-1-amine |
|---|---|
| PubChem CID | 64554825 |
| Molecular Formula | C11H12F5N |
| Molecular Weight | 253.21 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | N-[2-(3,5-difluorophenyl)ethyl]-3,3,3-trifluoropropan-1-amine |
| SMILES | Fc1cc(F)cc(CCNCCC(F)(F)F)c1 |
| InChI | InChI=1S/C11H12F5N/c12-9-5-8(6-10(13)7-9)1-3-17-4-2-11(14,15)16/h5-7,17H,1-4H2 |
| InChIKey | KBUNAASROQQCJB-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.21 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|