C12H17F2NO2S — CID 62616300
2-(3,5-difluorophenyl)-N-(2-ethylsulfonylethyl)ethanamine (PubChem CID 62616300) has the molecular formula C12H17F2NO2S and a molecular weight of 277.34 g/mol. Its IUPAC name is 2-(3,5-difluorophenyl)-N-(2-ethylsulfonylethyl)ethanamine.
| Compound Name | 2-(3,5-difluorophenyl)-N-(2-ethylsulfonylethyl)ethanamine |
|---|---|
| PubChem CID | 62616300 |
| Molecular Formula | C12H17F2NO2S |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 2-(3,5-difluorophenyl)-N-(2-ethylsulfonylethyl)ethanamine |
| SMILES | CCS(=O)(=O)CCNCCc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C12H17F2NO2S/c1-2-18(16,17)6-5-15-4-3-10-7-11(13)9-12(14)8-10/h7-9,15H,2-6H2,1H3 |
| InChIKey | RZIPSAMIDBYGFJ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|