C10H13F2NO — CID 62603879
2-[2-(3,5-difluorophenyl)ethylamino]ethanol (PubChem CID 62603879) has the molecular formula C10H13F2NO and a molecular weight of 201.22 g/mol. Its IUPAC name is 2-[2-(3,5-difluorophenyl)ethylamino]ethanol.
| Compound Name | 2-[2-(3,5-difluorophenyl)ethylamino]ethanol |
|---|---|
| PubChem CID | 62603879 |
| Molecular Formula | C10H13F2NO |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | 2-[2-(3,5-difluorophenyl)ethylamino]ethanol |
| SMILES | OCCNCCc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C10H13F2NO/c11-9-5-8(6-10(12)7-9)1-2-13-3-4-14/h5-7,13-14H,1-4H2 |
| InChIKey | AFCAVQWDXHQNST-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|