C10H10F2N2 — CID 62615420
2-[2-(3,5-difluorophenyl)ethylamino]acetonitrile (PubChem CID 62615420) has the molecular formula C10H10F2N2 and a molecular weight of 196.20 g/mol. Its IUPAC name is 2-[2-(3,5-difluorophenyl)ethylamino]acetonitrile.
| Compound Name | 2-[2-(3,5-difluorophenyl)ethylamino]acetonitrile |
|---|---|
| PubChem CID | 62615420 |
| Molecular Formula | C10H10F2N2 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | 2-[2-(3,5-difluorophenyl)ethylamino]acetonitrile |
| SMILES | N#CCNCCc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C10H10F2N2/c11-9-5-8(6-10(12)7-9)1-3-14-4-2-13/h5-7,14H,1,3-4H2 |
| InChIKey | GKNBECINQJMFST-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|