C12H14F2N2 — CID 62615603
3-[2-(3,5-difluorophenyl)ethylamino]-2-methylpropanenitrile (PubChem CID 62615603) has the molecular formula C12H14F2N2 and a molecular weight of 224.25 g/mol. Its IUPAC name is 3-[2-(3,5-difluorophenyl)ethylamino]-2-methylpropanenitrile.
| Compound Name | 3-[2-(3,5-difluorophenyl)ethylamino]-2-methylpropanenitrile |
|---|---|
| PubChem CID | 62615603 |
| Molecular Formula | C12H14F2N2 |
| Molecular Weight | 224.25 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 3-[2-(3,5-difluorophenyl)ethylamino]-2-methylpropanenitrile |
| SMILES | CC(C#N)CNCCc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C12H14F2N2/c1-9(7-15)8-16-3-2-10-4-11(13)6-12(14)5-10/h4-6,9,16H,2-3,8H2,1H3 |
| InChIKey | NCTCGSHWWFHZHB-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.25 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|