C14H20N2O2 — CID 43242740
3-[2-(3,4-dimethoxyphenyl)ethylamino]-2-methylpropanenitrile (PubChem CID 43242740) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is 3-[2-(3,4-dimethoxyphenyl)ethylamino]-2-methylpropanenitrile.
| Compound Name | 3-[2-(3,4-dimethoxyphenyl)ethylamino]-2-methylpropanenitrile |
|---|---|
| PubChem CID | 43242740 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | 3-[2-(3,4-dimethoxyphenyl)ethylamino]-2-methylpropanenitrile |
| SMILES | COc1ccc(CCNCC(C)C#N)cc1OC |
| InChI | InChI=1S/C14H20N2O2/c1-11(9-15)10-16-7-6-12-4-5-13(17-2)14(8-12)18-3/h4-5,8,11,16H,6-7,10H2,1-3H3 |
| InChIKey | MJSPMFDMAKIZIW-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 54.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|