C18H23Cl2NO3 — CID 21406688
1-(2-chlorophenyl)-2-[2-(3,4-dimethoxyphenyl)ethylamino]ethanol;hydrochloride (PubChem CID 21406688) has the molecular formula C18H23Cl2NO3 and a molecular weight of 372.29 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-2-[2-(3,4-dimethoxyphenyl)ethylamino]ethanol;hydrochloride.
| Compound Name | 1-(2-chlorophenyl)-2-[2-(3,4-dimethoxyphenyl)ethylamino]ethanol;hydrochloride |
|---|---|
| PubChem CID | 21406688 |
| Molecular Formula | C18H23Cl2NO3 |
| Molecular Weight | 372.29 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 1-(2-chlorophenyl)-2-[2-(3,4-dimethoxyphenyl)ethylamino]ethanol;hydrochloride |
| SMILES | COc1ccc(CCNCC(O)c2ccccc2Cl)cc1OC.Cl |
| InChI | InChI=1S/C18H22ClNO3.ClH/c1-22-17-8-7-13(11-18(17)23-2)9-10-20-12-16(21)14-5-3-4-6-15(14)19;/h3-8,11,16,20-21H,9-10,12H2,1-2H3;1H |
| InChIKey | JXVGZSPHVKDYJI-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.29 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|