C13H20ClNO3 — CID 151046701
1-chloro-3-[2-(3,4-dimethoxyphenyl)ethylamino]propan-1-ol (PubChem CID 151046701) has the molecular formula C13H20ClNO3 and a molecular weight of 273.76 g/mol. Its IUPAC name is 1-chloro-3-[2-(3,4-dimethoxyphenyl)ethylamino]propan-1-ol.
| Compound Name | 1-chloro-3-[2-(3,4-dimethoxyphenyl)ethylamino]propan-1-ol |
|---|---|
| PubChem CID | 151046701 |
| Molecular Formula | C13H20ClNO3 |
| Molecular Weight | 273.76 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 1-chloro-3-[2-(3,4-dimethoxyphenyl)ethylamino]propan-1-ol |
| SMILES | COc1ccc(CCNCCC(O)Cl)cc1OC |
| InChI | InChI=1S/C13H20ClNO3/c1-17-11-4-3-10(9-12(11)18-2)5-7-15-8-6-13(14)16/h3-4,9,13,15-16H,5-8H2,1-2H3 |
| InChIKey | MDFYJMQMMKMAJO-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.76 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|