C15H23NO4 — CID 43377806
methyl 4-[2-(3,4-dimethoxyphenyl)ethylamino]butanoate (PubChem CID 43377806) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is methyl 4-[2-(3,4-dimethoxyphenyl)ethylamino]butanoate.
| Compound Name | methyl 4-[2-(3,4-dimethoxyphenyl)ethylamino]butanoate |
|---|---|
| PubChem CID | 43377806 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | methyl 4-[2-(3,4-dimethoxyphenyl)ethylamino]butanoate |
| SMILES | COC(=O)CCCNCCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C15H23NO4/c1-18-13-7-6-12(11-14(13)19-2)8-10-16-9-4-5-15(17)20-3/h6-7,11,16H,4-5,8-10H2,1-3H3 |
| InChIKey | VJKLQDIULRTDQH-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|