C17H26N2O4S — CID 9054223
methyl 4-[[2-(3,4-dimethoxyphenyl)ethyl-methylcarbamothioyl]amino]butanoate (PubChem CID 9054223) has the molecular formula C17H26N2O4S and a molecular weight of 354.47 g/mol. Its IUPAC name is methyl 4-[[2-(3,4-dimethoxyphenyl)ethyl-methylcarbamothioyl]amino]butanoate.
| Compound Name | methyl 4-[[2-(3,4-dimethoxyphenyl)ethyl-methylcarbamothioyl]amino]butanoate |
|---|---|
| PubChem CID | 9054223 |
| Molecular Formula | C17H26N2O4S |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | methyl 4-[[2-(3,4-dimethoxyphenyl)ethyl-methylcarbamothioyl]amino]butanoate |
| SMILES | COC(=O)CCCNC(=S)N(C)CCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C17H26N2O4S/c1-19(17(24)18-10-5-6-16(20)23-4)11-9-13-7-8-14(21-2)15(12-13)22-3/h7-8,12H,5-6,9-11H2,1-4H3,(H,18,24) |
| InChIKey | AEGRQPCFTWYZKW-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|