C20H25FN2O2S — CID 9238302
1-[3-(3,4-dimethoxyphenyl)propyl]-3-[(4-fluorophenyl)methyl]-1-methylthiourea (PubChem CID 9238302) has the molecular formula C20H25FN2O2S and a molecular weight of 376.50 g/mol. Its IUPAC name is 1-[3-(3,4-dimethoxyphenyl)propyl]-3-[(4-fluorophenyl)methyl]-1-methylthiourea.
| Compound Name | 1-[3-(3,4-dimethoxyphenyl)propyl]-3-[(4-fluorophenyl)methyl]-1-methylthiourea |
|---|---|
| PubChem CID | 9238302 |
| Molecular Formula | C20H25FN2O2S |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 1-[3-(3,4-dimethoxyphenyl)propyl]-3-[(4-fluorophenyl)methyl]-1-methylthiourea |
| SMILES | COc1ccc(CCCN(C)C(=S)NCc2ccc(F)cc2)cc1OC |
| InChI | InChI=1S/C20H25FN2O2S/c1-23(20(26)22-14-16-6-9-17(21)10-7-16)12-4-5-15-8-11-18(24-2)19(13-15)25-3/h6-11,13H,4-5,12,14H2,1-3H3,(H,22,26) |
| InChIKey | KJZYVCRJTUZRBW-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|