C17H20N2O2S — CID 8669526
1-benzyl-3-[(3,4-dimethoxyphenyl)methyl]thiourea (PubChem CID 8669526) has the molecular formula C17H20N2O2S and a molecular weight of 316.43 g/mol. Its IUPAC name is 1-benzyl-3-[(3,4-dimethoxyphenyl)methyl]thiourea.
| Compound Name | 1-benzyl-3-[(3,4-dimethoxyphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 8669526 |
| Molecular Formula | C17H20N2O2S |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 1-benzyl-3-[(3,4-dimethoxyphenyl)methyl]thiourea |
| SMILES | COc1ccc(CNC(=S)NCc2ccccc2)cc1OC |
| InChI | InChI=1S/C17H20N2O2S/c1-20-15-9-8-14(10-16(15)21-2)12-19-17(22)18-11-13-6-4-3-5-7-13/h3-10H,11-12H2,1-2H3,(H2,18,19,22) |
| InChIKey | YYWSRSSAJXFXBA-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|