C19H20N2O3S — CID 1380290
(E)-N-(benzylcarbamothioyl)-3-(3,4-dimethoxyphenyl)prop-2-enamide (PubChem CID 1380290) has the molecular formula C19H20N2O3S and a molecular weight of 356.45 g/mol. Its IUPAC name is (E)-N-(benzylcarbamothioyl)-3-(3,4-dimethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-(benzylcarbamothioyl)-3-(3,4-dimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 1380290 |
| Molecular Formula | C19H20N2O3S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | (E)-N-(benzylcarbamothioyl)-3-(3,4-dimethoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)NC(=S)NCc2ccccc2)cc1OC |
| InChI | InChI=1S/C19H20N2O3S/c1-23-16-10-8-14(12-17(16)24-2)9-11-18(22)21-19(25)20-13-15-6-4-3-5-7-15/h3-12H,13H2,1-2H3,(H2,20,21,22,25)/b11-9+ |
| InChIKey | JHXBHOPLCXWIRT-PKNBQFBNSA-N |
| XLogP | 2.91 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|