C17H20N2O3S — CID 3659335
1-[(3,4-dimethoxyphenyl)methyl]-3-(4-methoxyphenyl)thiourea (PubChem CID 3659335) has the molecular formula C17H20N2O3S and a molecular weight of 332.43 g/mol. Its IUPAC name is 1-[(3,4-dimethoxyphenyl)methyl]-3-(4-methoxyphenyl)thiourea.
| Compound Name | 1-[(3,4-dimethoxyphenyl)methyl]-3-(4-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 3659335 |
| Molecular Formula | C17H20N2O3S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 1-[(3,4-dimethoxyphenyl)methyl]-3-(4-methoxyphenyl)thiourea |
| SMILES | COc1ccc(NC(=S)NCc2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C17H20N2O3S/c1-20-14-7-5-13(6-8-14)19-17(23)18-11-12-4-9-15(21-2)16(10-12)22-3/h4-10H,11H2,1-3H3,(H2,18,19,23) |
| InChIKey | UZVKXTZJRQQWNF-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 51.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|