C21H29FIN3O2 — CID 111307935
2-[2-(3,4-dimethoxyphenyl)ethyl]-3-ethyl-1-[(4-fluorophenyl)methyl]-1-methylguanidine;hydroiodide (PubChem CID 111307935) has the molecular formula C21H29FIN3O2 and a molecular weight of 501.38 g/mol. Its IUPAC name is 2-[2-(3,4-dimethoxyphenyl)ethyl]-3-ethyl-1-[(4-fluorophenyl)methyl]-1-methylguanidine;hydroiodide.
| Compound Name | 2-[2-(3,4-dimethoxyphenyl)ethyl]-3-ethyl-1-[(4-fluorophenyl)methyl]-1-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111307935 |
| Molecular Formula | C21H29FIN3O2 |
| Molecular Weight | 501.38 g/mol |
| Exact Mass | 501.13 |
| IUPAC Name | 2-[2-(3,4-dimethoxyphenyl)ethyl]-3-ethyl-1-[(4-fluorophenyl)methyl]-1-methylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CCc1ccc(OC)c(OC)c1)N(C)Cc1ccc(F)cc1.I |
| InChI | InChI=1S/C21H28FN3O2.HI/c1-5-23-21(25(2)15-17-6-9-18(22)10-7-17)24-13-12-16-8-11-19(26-3)20(14-16)27-4;/h6-11,14H,5,12-13,15H2,1-4H3,(H,23,24);1H |
| InChIKey | SEZDJRZHCHYIIP-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.38 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|