C24H33FN4O3 — CID 111241923
2-[[[[2-(3,4-dimethoxyphenyl)ethyl-methylamino]-(ethylamino)methylidene]amino]methyl]-3-(4-fluorophenyl)propanamide (PubChem CID 111241923) has the molecular formula C24H33FN4O3 and a molecular weight of 444.55 g/mol. Its IUPAC name is 2-[[[[2-(3,4-dimethoxyphenyl)ethyl-methylamino]-(ethylamino)methylidene]amino]methyl]-3-(4-fluorophenyl)propanamide.
| Compound Name | 2-[[[[2-(3,4-dimethoxyphenyl)ethyl-methylamino]-(ethylamino)methylidene]amino]methyl]-3-(4-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 111241923 |
| Molecular Formula | C24H33FN4O3 |
| Molecular Weight | 444.55 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | 2-[[[[2-(3,4-dimethoxyphenyl)ethyl-methylamino]-(ethylamino)methylidene]amino]methyl]-3-(4-fluorophenyl)propanamide |
| SMILES | CCN/C(=N\CC(Cc1ccc(F)cc1)C(N)=O)N(C)CCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C24H33FN4O3/c1-5-27-24(28-16-19(23(26)30)14-17-6-9-20(25)10-7-17)29(2)13-12-18-8-11-21(31-3)22(15-18)32-4/h6-11,15,19H,5,12-14,16H2,1-4H3,(H2,26,30)(H,27,28) |
| InChIKey | RNENTEAPCPEHOC-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.55 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|