C13H20N2O4 — CID 15675522
3-[3-(3,4-dimethoxyphenyl)propyl]-1-hydroxy-1-methylurea (PubChem CID 15675522) has the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. Its IUPAC name is 3-[3-(3,4-dimethoxyphenyl)propyl]-1-hydroxy-1-methylurea.
| Compound Name | 3-[3-(3,4-dimethoxyphenyl)propyl]-1-hydroxy-1-methylurea |
|---|---|
| PubChem CID | 15675522 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 3-[3-(3,4-dimethoxyphenyl)propyl]-1-hydroxy-1-methylurea |
| SMILES | COc1ccc(CCCNC(=O)N(C)O)cc1OC |
| InChI | InChI=1S/C13H20N2O4/c1-15(17)13(16)14-8-4-5-10-6-7-11(18-2)12(9-10)19-3/h6-7,9,17H,4-5,8H2,1-3H3,(H,14,16) |
| InChIKey | MLJXOCXSDYOPAF-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|