C19H24N2O3 — CID 16573334
1-benzyl-3-[2-(3,4-dimethoxyphenyl)ethyl]-1-methylurea (PubChem CID 16573334) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is 1-benzyl-3-[2-(3,4-dimethoxyphenyl)ethyl]-1-methylurea.
| Compound Name | 1-benzyl-3-[2-(3,4-dimethoxyphenyl)ethyl]-1-methylurea |
|---|---|
| PubChem CID | 16573334 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | 1-benzyl-3-[2-(3,4-dimethoxyphenyl)ethyl]-1-methylurea |
| SMILES | COc1ccc(CCNC(=O)N(C)Cc2ccccc2)cc1OC |
| InChI | InChI=1S/C19H24N2O3/c1-21(14-16-7-5-4-6-8-16)19(22)20-12-11-15-9-10-17(23-2)18(13-15)24-3/h4-10,13H,11-12,14H2,1-3H3,(H,20,22) |
| InChIKey | NMBGRZBJFQZMFD-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |