C22H28N2O4 — CID 108503366
N'-benzyl-N-[2-(3,4-dimethoxyphenyl)ethyl]-N'-propan-2-yloxamide (PubChem CID 108503366) has the molecular formula C22H28N2O4 and a molecular weight of 384.48 g/mol. Its IUPAC name is N'-benzyl-N-[2-(3,4-dimethoxyphenyl)ethyl]-N'-propan-2-yloxamide.
| Compound Name | N'-benzyl-N-[2-(3,4-dimethoxyphenyl)ethyl]-N'-propan-2-yloxamide |
|---|---|
| PubChem CID | 108503366 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | N'-benzyl-N-[2-(3,4-dimethoxyphenyl)ethyl]-N'-propan-2-yloxamide |
| SMILES | COc1ccc(CCNC(=O)C(=O)N(Cc2ccccc2)C(C)C)cc1OC |
| InChI | InChI=1S/C22H28N2O4/c1-16(2)24(15-18-8-6-5-7-9-18)22(26)21(25)23-13-12-17-10-11-19(27-3)20(14-17)28-4/h5-11,14,16H,12-13,15H2,1-4H3,(H,23,25) |
| InChIKey | DOBHAJNHGRALED-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|