C16H24N2O4 — CID 3102524
N-[2-(3,4-dimethoxyphenyl)ethyl]-N'-(2-methylpropyl)oxamide (PubChem CID 3102524) has the molecular formula C16H24N2O4 and a molecular weight of 308.38 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-N'-(2-methylpropyl)oxamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N'-(2-methylpropyl)oxamide |
|---|---|
| PubChem CID | 3102524 |
| Molecular Formula | C16H24N2O4 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N'-(2-methylpropyl)oxamide |
| SMILES | COc1ccc(CCNC(=O)C(=O)NCC(C)C)cc1OC |
| InChI | InChI=1S/C16H24N2O4/c1-11(2)10-18-16(20)15(19)17-8-7-12-5-6-13(21-3)14(9-12)22-4/h5-6,9,11H,7-8,10H2,1-4H3,(H,17,19)(H,18,20) |
| InChIKey | DNCLHUYMDIXRGQ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|