C21H26N2O5 — CID 108985428
N'-[2-(3,4-dimethoxyphenyl)ethyl]-N-[2-(3-methoxyphenyl)ethyl]oxamide (PubChem CID 108985428) has the molecular formula C21H26N2O5 and a molecular weight of 386.45 g/mol. Its IUPAC name is N'-[2-(3,4-dimethoxyphenyl)ethyl]-N-[2-(3-methoxyphenyl)ethyl]oxamide.
| Compound Name | N'-[2-(3,4-dimethoxyphenyl)ethyl]-N-[2-(3-methoxyphenyl)ethyl]oxamide |
|---|---|
| PubChem CID | 108985428 |
| Molecular Formula | C21H26N2O5 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | N'-[2-(3,4-dimethoxyphenyl)ethyl]-N-[2-(3-methoxyphenyl)ethyl]oxamide |
| SMILES | COc1cccc(CCNC(=O)C(=O)NCCc2ccc(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C21H26N2O5/c1-26-17-6-4-5-15(13-17)9-11-22-20(24)21(25)23-12-10-16-7-8-18(27-2)19(14-16)28-3/h4-8,13-14H,9-12H2,1-3H3,(H,22,24)(H,23,25) |
| InChIKey | YHOOKNVALLXZRJ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|