C14H18N2O3 — CID 44995985
N-[2-(3-methoxyphenyl)ethyl]-N'-prop-2-enyloxamide (PubChem CID 44995985) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is N-[2-(3-methoxyphenyl)ethyl]-N'-prop-2-enyloxamide.
| Compound Name | N-[2-(3-methoxyphenyl)ethyl]-N'-prop-2-enyloxamide |
|---|---|
| PubChem CID | 44995985 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | N-[2-(3-methoxyphenyl)ethyl]-N'-prop-2-enyloxamide |
| SMILES | C=CCNC(=O)C(=O)NCCc1cccc(OC)c1 |
| InChI | InChI=1S/C14H18N2O3/c1-3-8-15-13(17)14(18)16-9-7-11-5-4-6-12(10-11)19-2/h3-6,10H,1,7-9H2,2H3,(H,15,17)(H,16,18) |
| InChIKey | JKYWQDOOYQWXDZ-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|