C13H15N3O3 — CID 2244283
N'-[(3-methoxyphenyl)methylideneamino]-N-prop-2-enyloxamide (PubChem CID 2244283) has the molecular formula C13H15N3O3 and a molecular weight of 261.28 g/mol. Its IUPAC name is N'-[(3-methoxyphenyl)methylideneamino]-N-prop-2-enyloxamide.
| Compound Name | N'-[(3-methoxyphenyl)methylideneamino]-N-prop-2-enyloxamide |
|---|---|
| PubChem CID | 2244283 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | N'-[(3-methoxyphenyl)methylideneamino]-N-prop-2-enyloxamide |
| SMILES | C=CCNC(=O)C(=O)NN=Cc1cccc(OC)c1 |
| InChI | InChI=1S/C13H15N3O3/c1-3-7-14-12(17)13(18)16-15-9-10-5-4-6-11(8-10)19-2/h3-6,8-9H,1,7H2,2H3,(H,14,17)(H,16,18) |
| InChIKey | HVOQLWWTKROKSH-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|