C12H12N4O4 — CID 40531263
N'-[(Z)-(3-nitrophenyl)methylideneamino]-N-prop-2-enyloxamide (PubChem CID 40531263) has the molecular formula C12H12N4O4 and a molecular weight of 276.25 g/mol. Its IUPAC name is N'-[(Z)-(3-nitrophenyl)methylideneamino]-N-prop-2-enyloxamide.
| Compound Name | N'-[(Z)-(3-nitrophenyl)methylideneamino]-N-prop-2-enyloxamide |
|---|---|
| PubChem CID | 40531263 |
| Molecular Formula | C12H12N4O4 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | N'-[(Z)-(3-nitrophenyl)methylideneamino]-N-prop-2-enyloxamide |
| SMILES | C=CCNC(=O)C(=O)N/N=C\c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H12N4O4/c1-2-6-13-11(17)12(18)15-14-8-9-4-3-5-10(7-9)16(19)20/h2-5,7-8H,1,6H2,(H,13,17)(H,15,18)/b14-8- |
| InChIKey | VSPJFYWELHSCRW-ZSOIEALJSA-N |
| XLogP | 0.35 |
| TPSA | 113.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|