C16H14N4O4 — CID 46741725
N-benzyl-N'-[(E)-(3-nitrophenyl)methylideneamino]oxamide (PubChem CID 46741725) has the molecular formula C16H14N4O4 and a molecular weight of 326.31 g/mol. Its IUPAC name is N-benzyl-N'-[(E)-(3-nitrophenyl)methylideneamino]oxamide.
| Compound Name | N-benzyl-N'-[(E)-(3-nitrophenyl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 46741725 |
| Molecular Formula | C16H14N4O4 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | N-benzyl-N'-[(E)-(3-nitrophenyl)methylideneamino]oxamide |
| SMILES | O=C(NCc1ccccc1)C(=O)N/N=C/c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H14N4O4/c21-15(17-10-12-5-2-1-3-6-12)16(22)19-18-11-13-7-4-8-14(9-13)20(23)24/h1-9,11H,10H2,(H,17,21)(H,19,22)/b18-11+ |
| InChIKey | ICGLIPKXVLKHNL-WOJGMQOQSA-N |
| XLogP | 1.36 |
| TPSA | 113.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|