C18H18N4O4 — CID 8990324
N'-[(Z)-[3-(2-amino-2-oxoethoxy)phenyl]methylideneamino]-N-benzyloxamide (PubChem CID 8990324) has the molecular formula C18H18N4O4 and a molecular weight of 354.37 g/mol. Its IUPAC name is N'-[(Z)-[3-(2-amino-2-oxoethoxy)phenyl]methylideneamino]-N-benzyloxamide.
| Compound Name | N'-[(Z)-[3-(2-amino-2-oxoethoxy)phenyl]methylideneamino]-N-benzyloxamide |
|---|---|
| PubChem CID | 8990324 |
| Molecular Formula | C18H18N4O4 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | N'-[(Z)-[3-(2-amino-2-oxoethoxy)phenyl]methylideneamino]-N-benzyloxamide |
| SMILES | NC(=O)COc1cccc(/C=N\NC(=O)C(=O)NCc2ccccc2)c1 |
| InChI | InChI=1S/C18H18N4O4/c19-16(23)12-26-15-8-4-7-14(9-15)11-21-22-18(25)17(24)20-10-13-5-2-1-3-6-13/h1-9,11H,10,12H2,(H2,19,23)(H,20,24)(H,22,25)/b21-11- |
| InChIKey | LZKATFUMNAWQDP-NHDPSOOVSA-N |
| XLogP | 0.32 |
| TPSA | 122.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|