C25H23ClN4O5 — CID 126279830
N'-[(Z)-[3-[2-(2-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-[(4-methoxyphenyl)methyl]oxamide (PubChem CID 126279830) has the molecular formula C25H23ClN4O5 and a molecular weight of 494.94 g/mol. Its IUPAC name is N'-[(Z)-[3-[2-(2-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-[(4-methoxyphenyl)methyl]oxamide.
| Compound Name | N'-[(Z)-[3-[2-(2-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-[(4-methoxyphenyl)methyl]oxamide |
|---|---|
| PubChem CID | 126279830 |
| Molecular Formula | C25H23ClN4O5 |
| Molecular Weight | 494.94 g/mol |
| Exact Mass | 494.14 |
| IUPAC Name | N'-[(Z)-[3-[2-(2-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-[(4-methoxyphenyl)methyl]oxamide |
| SMILES | COc1ccc(CNC(=O)C(=O)N/N=C\c2cccc(OCC(=O)Nc3ccccc3Cl)c2)cc1 |
| InChI | InChI=1S/C25H23ClN4O5/c1-34-19-11-9-17(10-12-19)14-27-24(32)25(33)30-28-15-18-5-4-6-20(13-18)35-16-23(31)29-22-8-3-2-7-21(22)26/h2-13,15H,14,16H2,1H3,(H,27,32)(H,29,31)(H,30,33)/b28-15- |
| InChIKey | ZXINBYPUPSVHBF-MBTHVWNTSA-N |
| XLogP | 3.13 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.94 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|