C24H21ClN4O5 — CID 126180453
N'-[(Z)-[3-[2-(2-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(3-methoxyphenyl)oxamide (PubChem CID 126180453) has the molecular formula C24H21ClN4O5 and a molecular weight of 480.91 g/mol. Its IUPAC name is N'-[(Z)-[3-[2-(2-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(3-methoxyphenyl)oxamide.
| Compound Name | N'-[(Z)-[3-[2-(2-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(3-methoxyphenyl)oxamide |
|---|---|
| PubChem CID | 126180453 |
| Molecular Formula | C24H21ClN4O5 |
| Molecular Weight | 480.91 g/mol |
| Exact Mass | 480.12 |
| IUPAC Name | N'-[(Z)-[3-[2-(2-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(3-methoxyphenyl)oxamide |
| SMILES | COc1cccc(NC(=O)C(=O)N/N=C\c2cccc(OCC(=O)Nc3ccccc3Cl)c2)c1 |
| InChI | InChI=1S/C24H21ClN4O5/c1-33-18-8-5-7-17(13-18)27-23(31)24(32)29-26-14-16-6-4-9-19(12-16)34-15-22(30)28-21-11-3-2-10-20(21)25/h2-14H,15H2,1H3,(H,27,31)(H,28,30)(H,29,32)/b26-14- |
| InChIKey | SQMMKCJSLMJMGC-WGARJPEWSA-N |
| XLogP | 3.45 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.91 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|