C24H30N2O5 — CID 10895204
(2S)-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-methyl-2-[(2-oxo-3-phenylpropanoyl)amino]butanamide (PubChem CID 10895204) has the molecular formula C24H30N2O5 and a molecular weight of 426.51 g/mol. Its IUPAC name is (2S)-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-methyl-2-[(2-oxo-3-phenylpropanoyl)amino]butanamide.
| Compound Name | (2S)-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-methyl-2-[(2-oxo-3-phenylpropanoyl)amino]butanamide |
|---|---|
| PubChem CID | 10895204 |
| Molecular Formula | C24H30N2O5 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | (2S)-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-methyl-2-[(2-oxo-3-phenylpropanoyl)amino]butanamide |
| SMILES | COc1ccc(CCNC(=O)[C@@H](NC(=O)C(=O)Cc2ccccc2)C(C)C)cc1OC |
| InChI | InChI=1S/C24H30N2O5/c1-16(2)22(26-23(28)19(27)14-17-8-6-5-7-9-17)24(29)25-13-12-18-10-11-20(30-3)21(15-18)31-4/h5-11,15-16,22H,12-14H2,1-4H3,(H,25,29)(H,26,28)/t22-/m0/s1 |
| InChIKey | ZFHWAPYTKLRVLU-QFIPXVFZSA-N |
| XLogP | 2.32 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|