C23H31N3O4 — CID 55543538
2-(benzylcarbamoylamino)-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-methylbutanamide (PubChem CID 55543538) has the molecular formula C23H31N3O4 and a molecular weight of 413.52 g/mol. Its IUPAC name is 2-(benzylcarbamoylamino)-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-methylbutanamide.
| Compound Name | 2-(benzylcarbamoylamino)-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 55543538 |
| Molecular Formula | C23H31N3O4 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.23 |
| IUPAC Name | 2-(benzylcarbamoylamino)-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-methylbutanamide |
| SMILES | COc1ccc(CCNC(=O)C(NC(=O)NCc2ccccc2)C(C)C)cc1OC |
| InChI | InChI=1S/C23H31N3O4/c1-16(2)21(26-23(28)25-15-18-8-6-5-7-9-18)22(27)24-13-12-17-10-11-19(29-3)20(14-17)30-4/h5-11,14,16,21H,12-13,15H2,1-4H3,(H,24,27)(H2,25,26,28) |
| InChIKey | ZWVXOJBTKGAZJR-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |