C20H24N2O5 — CID 4679001
2-[2-(3,4-dimethoxyphenyl)ethylcarbamoylamino]-3-phenylpropanoic acid (PubChem CID 4679001) has the molecular formula C20H24N2O5 and a molecular weight of 372.42 g/mol. Its IUPAC name is 2-[2-(3,4-dimethoxyphenyl)ethylcarbamoylamino]-3-phenylpropanoic acid.
| Compound Name | 2-[2-(3,4-dimethoxyphenyl)ethylcarbamoylamino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 4679001 |
| Molecular Formula | C20H24N2O5 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 2-[2-(3,4-dimethoxyphenyl)ethylcarbamoylamino]-3-phenylpropanoic acid |
| SMILES | COc1ccc(CCNC(=O)NC(Cc2ccccc2)C(=O)O)cc1OC |
| InChI | InChI=1S/C20H24N2O5/c1-26-17-9-8-15(13-18(17)27-2)10-11-21-20(25)22-16(19(23)24)12-14-6-4-3-5-7-14/h3-9,13,16H,10-12H2,1-2H3,(H,23,24)(H2,21,22,25) |
| InChIKey | PNGVGAQFSRMSBF-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |