C24H26N2O3 — CID 41327613
1-benzhydryl-3-[2-(3,4-dimethoxyphenyl)ethyl]urea (PubChem CID 41327613) has the molecular formula C24H26N2O3 and a molecular weight of 390.48 g/mol. Its IUPAC name is 1-benzhydryl-3-[2-(3,4-dimethoxyphenyl)ethyl]urea.
| Compound Name | 1-benzhydryl-3-[2-(3,4-dimethoxyphenyl)ethyl]urea |
|---|---|
| PubChem CID | 41327613 |
| Molecular Formula | C24H26N2O3 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 1-benzhydryl-3-[2-(3,4-dimethoxyphenyl)ethyl]urea |
| SMILES | COc1ccc(CCNC(=O)NC(c2ccccc2)c2ccccc2)cc1OC |
| InChI | InChI=1S/C24H26N2O3/c1-28-21-14-13-18(17-22(21)29-2)15-16-25-24(27)26-23(19-9-5-3-6-10-19)20-11-7-4-8-12-20/h3-14,17,23H,15-16H2,1-2H3,(H2,25,26,27) |
| InChIKey | FDVXZCJHAOJPPO-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |